C14H17FO6S — CID 177111303
2-[4-fluoro-3-(2-methylbut-3-en-2-yloxy)benzoyl]oxyethanesulfonic acid (PubChem CID 177111303) has the molecular formula C14H17FO6S and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-[4-fluoro-3-(2-methylbut-3-en-2-yloxy)benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[4-fluoro-3-(2-methylbut-3-en-2-yloxy)benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177111303 |
| Molecular Formula | C14H17FO6S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-[4-fluoro-3-(2-methylbut-3-en-2-yloxy)benzoyl]oxyethanesulfonic acid |
| SMILES | C=CC(C)(C)Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1F |
| InChI | InChI=1S/C14H17FO6S/c1-4-14(2,3)21-12-9-10(5-6-11(12)15)13(16)20-7-8-22(17,18)19/h4-6,9H,1,7-8H2,2-3H3,(H,17,18,19) |
| InChIKey | HQHJIUNNGFYFEU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|