C20H18FO6S- — CID 177112268
2-[4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxybenzoyl]oxyethanesulfonate (PubChem CID 177112268) has the molecular formula C20H18FO6S- and a molecular weight of 405.42 g/mol. Its IUPAC name is 2-[4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxybenzoyl]oxyethanesulfonate.
| Compound Name | 2-[4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxybenzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177112268 |
| Molecular Formula | C20H18FO6S- |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxybenzoyl]oxyethanesulfonate |
| SMILES | CC(C)(C#Cc1ccccc1)Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1F |
| InChI | InChI=1S/C20H19FO6S/c1-20(2,11-10-15-6-4-3-5-7-15)27-18-14-16(8-9-17(18)21)19(22)26-12-13-28(23,24)25/h3-9,14H,12-13H2,1-2H3,(H,23,24,25)/p-1 |
| InChIKey | SOEQYISUMPFVKL-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|