C16H20F3O8S- — CID 177111498
2-[3-(1-methoxy-2,2-dimethylpropoxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate (PubChem CID 177111498) has the molecular formula C16H20F3O8S- and a molecular weight of 429.39 g/mol. Its IUPAC name is 2-[3-(1-methoxy-2,2-dimethylpropoxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-(1-methoxy-2,2-dimethylpropoxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111498 |
| Molecular Formula | C16H20F3O8S- |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[3-(1-methoxy-2,2-dimethylpropoxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
| SMILES | COC(Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1OC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C16H21F3O8S/c1-15(2,3)14(24-4)26-12-9-10(5-6-11(12)27-16(17,18)19)13(20)25-7-8-28(21,22)23/h5-6,9,14H,7-8H2,1-4H3,(H,21,22,23)/p-1 |
| InChIKey | JOSJMNUZJNYSLD-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|