C24H30F3O7S- — CID 177111071
2-[3-[2-(8-tricyclo[5.2.1.02,6]decanyl)butan-2-yloxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate (PubChem CID 177111071) has the molecular formula C24H30F3O7S- and a molecular weight of 519.56 g/mol. Its IUPAC name is 2-[3-[2-(8-tricyclo[5.2.1.02,6]decanyl)butan-2-yloxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[2-(8-tricyclo[5.2.1.02,6]decanyl)butan-2-yloxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111071 |
| Molecular Formula | C24H30F3O7S- |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-[3-[2-(8-tricyclo[5.2.1.02,6]decanyl)butan-2-yloxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
| SMILES | CCC(C)(Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1OC(F)(F)F)C1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H31F3O7S/c1-3-23(2,19-12-15-11-18(19)17-6-4-5-16(15)17)33-21-13-14(7-8-20(21)34-24(25,26)27)22(28)32-9-10-35(29,30)31/h7-8,13,15-19H,3-6,9-12H2,1-2H3,(H,29,30,31)/p-1 |
| InChIKey | BBWJDLBURSTIDY-UHFFFAOYSA-M |
| XLogP | 4.91 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|