C19H22F3O7S- — CID 177111100
2-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate (PubChem CID 177111100) has the molecular formula C19H22F3O7S- and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111100 |
| Molecular Formula | C19H22F3O7S- |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
| SMILES | CCC1(Oc2cc(C(=O)OCCS(=O)(=O)[O-])ccc2OC(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C19H23F3O7S/c1-2-18(11-12-3-5-14(18)9-12)28-16-10-13(4-6-15(16)29-19(20,21)22)17(23)27-7-8-30(24,25)26/h4,6,10,12,14H,2-3,5,7-9,11H2,1H3,(H,24,25,26)/p-1 |
| InChIKey | HHMUMYWYULVPKW-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|