C25H30F3O6S- — CID 177111281
2-[3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate (PubChem CID 177111281) has the molecular formula C25H30F3O6S- and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111281 |
| Molecular Formula | C25H30F3O6S- |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
| SMILES | CC(C)C1(Oc2cc(C(=O)OCCS(=O)(=O)[O-])ccc2C(F)(F)F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C25H31F3O6S/c1-13(2)24(12-17-10-19(24)22-15-4-3-14(9-15)21(17)22)34-20-11-16(5-6-18(20)25(26,27)28)23(29)33-7-8-35(30,31)32/h5-6,11,13-15,17,19,21-22H,3-4,7-10,12H2,1-2H3,(H,30,31,32)/p-1 |
| InChIKey | IMGWVAJNDACZEW-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|