C18H20F3O6S- — CID 177112187
2-[3-[(2-methyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate (PubChem CID 177112187) has the molecular formula C18H20F3O6S- and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[3-[(2-methyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[(2-methyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177112187 |
| Molecular Formula | C18H20F3O6S- |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[3-[(2-methyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
| SMILES | CC1(Oc2cc(C(=O)OCCS(=O)(=O)[O-])ccc2C(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C18H21F3O6S/c1-17(10-11-2-4-13(17)8-11)27-15-9-12(3-5-14(15)18(19,20)21)16(22)26-6-7-28(23,24)25/h3,5,9,11,13H,2,4,6-8,10H2,1H3,(H,23,24,25)/p-1 |
| InChIKey | OLFYKLMDFMCCEW-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|