C20H24F3O7S- — CID 177111092
2-[3-[(2-propan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate (PubChem CID 177111092) has the molecular formula C20H24F3O7S- and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-[3-[(2-propan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[(2-propan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111092 |
| Molecular Formula | C20H24F3O7S- |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[3-[(2-propan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-(trifluoromethoxy)benzoyl]oxyethanesulfonate |
| SMILES | CC(C)C1(Oc2cc(C(=O)OCCS(=O)(=O)[O-])ccc2OC(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C20H25F3O7S/c1-12(2)19(11-13-3-5-15(19)9-13)29-17-10-14(4-6-16(17)30-20(21,22)23)18(24)28-7-8-31(25,26)27/h4,6,10,12-13,15H,3,5,7-9,11H2,1-2H3,(H,25,26,27)/p-1 |
| InChIKey | VTLXKUFXIAPSDQ-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|