C26H27F2IO9S — CID 177112213
2-[4-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4,5-difluorobenzoyl]oxy-3-iodo-5-methoxybenzoyl]oxyethanesulfonic acid (PubChem CID 177112213) has the molecular formula C26H27F2IO9S and a molecular weight of 680.46 g/mol. Its IUPAC name is 2-[4-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4,5-difluorobenzoyl]oxy-3-iodo-5-methoxybenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[4-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4,5-difluorobenzoyl]oxy-3-iodo-5-methoxybenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112213 |
| Molecular Formula | C26H27F2IO9S |
| Molecular Weight | 680.46 g/mol |
| Exact Mass | 680.04 |
| IUPAC Name | 2-[4-[3-[(2-ethyl-2-bicyclo[2.2.1]heptanyl)oxy]-4,5-difluorobenzoyl]oxy-3-iodo-5-methoxybenzoyl]oxyethanesulfonic acid |
| SMILES | CCC1(Oc2cc(C(=O)Oc3c(I)cc(C(=O)OCCS(=O)(=O)O)cc3OC)cc(F)c2F)CC2CCC1C2 |
| InChI | InChI=1S/C26H27F2IO9S/c1-3-26(13-14-4-5-17(26)8-14)38-20-11-15(9-18(27)22(20)28)25(31)37-23-19(29)10-16(12-21(23)35-2)24(30)36-6-7-39(32,33)34/h9-12,14,17H,3-8,13H2,1-2H3,(H,32,33,34) |
| InChIKey | XAIORWJPOSGPKW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|