C20H16F4I2O8S — CID 176607383
4-[3,5-diiodo-4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 176607383) has the molecular formula C20H16F4I2O8S and a molecular weight of 746.21 g/mol. Its IUPAC name is 4-[3,5-diiodo-4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[3,5-diiodo-4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 176607383 |
| Molecular Formula | C20H16F4I2O8S |
| Molecular Weight | 746.21 g/mol |
| Exact Mass | 745.86 |
| IUPAC Name | 4-[3,5-diiodo-4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)C(=O)OCCOc1c(I)cc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1I |
| InChI | InChI=1S/C20H16F4I2O8S/c1-3-8(2)19(27)33-5-4-32-16-10(25)6-9(7-11(16)26)20(28)34-17-12(21)14(23)18(35(29,30)31)15(24)13(17)22/h6-8H,3-5H2,1-2H3,(H,29,30,31) |
| InChIKey | RPQSOFDDKPTLLR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|