C13H3F4I3O5S — CID 153471718
2,3,5,6-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonic acid (PubChem CID 153471718) has the molecular formula C13H3F4I3O5S and a molecular weight of 727.93 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 153471718 |
| Molecular Formula | C13H3F4I3O5S |
| Molecular Weight | 727.93 g/mol |
| Exact Mass | 727.68 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H3F4I3O5S/c14-6-8(16)12(26(22,23)24)9(17)7(15)11(6)25-13(21)4-1-3(18)2-5(19)10(4)20/h1-2H,(H,22,23,24) |
| InChIKey | XPZIKDDZQXCHDD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|