C19H7F6I3O6S — CID 176596798
1,3,4,5,7,8-hexafluoro-6-[2-(2,3,5-triiodobenzoyl)oxyethoxy]naphthalene-2-sulfonic acid (PubChem CID 176596798) has the molecular formula C19H7F6I3O6S and a molecular weight of 858.03 g/mol. Its IUPAC name is 1,3,4,5,7,8-hexafluoro-6-[2-(2,3,5-triiodobenzoyl)oxyethoxy]naphthalene-2-sulfonic acid.
| Compound Name | 1,3,4,5,7,8-hexafluoro-6-[2-(2,3,5-triiodobenzoyl)oxyethoxy]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 176596798 |
| Molecular Formula | C19H7F6I3O6S |
| Molecular Weight | 858.03 g/mol |
| Exact Mass | 857.70 |
| IUPAC Name | 1,3,4,5,7,8-hexafluoro-6-[2-(2,3,5-triiodobenzoyl)oxyethoxy]naphthalene-2-sulfonic acid |
| SMILES | O=C(OCCOc1c(F)c(F)c2c(F)c(S(=O)(=O)O)c(F)c(F)c2c1F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C19H7F6I3O6S/c20-10-9-8(11(21)15(25)18(13(9)23)35(30,31)32)12(22)17(14(10)24)33-1-2-34-19(29)6-3-5(26)4-7(27)16(6)28/h3-4H,1-2H2,(H,30,31,32) |
| InChIKey | XMBDCIXUHSVEPY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|