C17H11F2I3O7S — CID 153471677
2,3-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonic acid (PubChem CID 153471677) has the molecular formula C17H11F2I3O7S and a molecular weight of 778.04 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonic acid.
| Compound Name | 2,3-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 153471677 |
| Molecular Formula | C17H11F2I3O7S |
| Molecular Weight | 778.04 g/mol |
| Exact Mass | 777.73 |
| IUPAC Name | 2,3-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonic acid |
| SMILES | O=C(CCCOC(=O)c1cc(I)cc(I)c1I)Oc1ccc(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C17H11F2I3O7S/c18-14-11(3-4-12(15(14)19)30(25,26)27)29-13(23)2-1-5-28-17(24)9-6-8(20)7-10(21)16(9)22/h3-4,6-7H,1-2,5H2,(H,25,26,27) |
| InChIKey | PSLDGTQBPCZCHD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|