C20H26I3NO5 — CID 170394499
[4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-4-oxobutyl] 2,3,5-triiodobenzoate (PubChem CID 170394499) has the molecular formula C20H26I3NO5 and a molecular weight of 741.14 g/mol. Its IUPAC name is [4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-4-oxobutyl] 2,3,5-triiodobenzoate.
| Compound Name | [4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-4-oxobutyl] 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 170394499 |
| Molecular Formula | C20H26I3NO5 |
| Molecular Weight | 741.14 g/mol |
| Exact Mass | 740.89 |
| IUPAC Name | [4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-4-oxobutyl] 2,3,5-triiodobenzoate |
| SMILES | CC1(C)CC(OC(=O)CCCOC(=O)c2cc(I)cc(I)c2I)CC(C)(C)N1O |
| InChI | InChI=1S/C20H26I3NO5/c1-19(2)10-13(11-20(3,4)24(19)27)29-16(25)6-5-7-28-18(26)14-8-12(21)9-15(22)17(14)23/h8-9,13,27H,5-7,10-11H2,1-4H3 |
| InChIKey | MFRRENGYFBOPAQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.14 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|