C19H35NO5 — CID 66790279
10-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-10-oxodecanoic acid (PubChem CID 66790279) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is 10-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-10-oxodecanoic acid.
| Compound Name | 10-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-10-oxodecanoic acid |
|---|---|
| PubChem CID | 66790279 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 10-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-10-oxodecanoic acid |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)O)CC(C)(C)N1O |
| InChI | InChI=1S/C19H35NO5/c1-18(2)13-15(14-19(3,4)20(18)24)25-17(23)12-10-8-6-5-7-9-11-16(21)22/h15,24H,5-14H2,1-4H3,(H,21,22) |
| InChIKey | JTRAZPKCBATXMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|