C38H70N2O8 — CID 159079251
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;decanedioic acid (PubChem CID 159079251) has the molecular formula C38H70N2O8 and a molecular weight of 682.98 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;decanedioic acid.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;decanedioic acid |
|---|---|
| PubChem CID | 159079251 |
| Molecular Formula | C38H70N2O8 |
| Molecular Weight | 682.98 g/mol |
| Exact Mass | 682.51 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;decanedioic acid |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H52N2O4.C10H18O4/c1-25(2)17-21(18-26(3,4)29-25)33-23(31)15-13-11-9-10-12-14-16-24(32)34-22-19-27(5,6)30-28(7,8)20-22;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h21-22,29-30H,9-20H2,1-8H3;1-8H2,(H,11,12)(H,13,14) |
| InChIKey | KAQNKDWPKUUFRK-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.98 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|