C29H54N2O4 — CID 121244522
bis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptanedioate (PubChem CID 121244522) has the molecular formula C29H54N2O4 and a molecular weight of 494.76 g/mol. Its IUPAC name is bis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptanedioate.
| Compound Name | bis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptanedioate |
|---|---|
| PubChem CID | 121244522 |
| Molecular Formula | C29H54N2O4 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | bis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptanedioate |
| SMILES | CC(C)C1(C)CC(OC(=O)CCCCCC(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C29H54N2O4/c1-20(2)28(9)18-22(16-26(5,6)30-28)34-24(32)14-12-11-13-15-25(33)35-23-17-27(7,8)31-29(10,19-23)21(3)4/h20-23,30-31H,11-19H2,1-10H3 |
| InChIKey | AXKPJHUYSDUHCH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|