C52H94N4O8 — CID 121247839
tetrakis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) butane-1,1,2,4-tetracarboxylate (PubChem CID 121247839) has the molecular formula C52H94N4O8 and a molecular weight of 903.34 g/mol. Its IUPAC name is tetrakis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) butane-1,1,2,4-tetracarboxylate.
| Compound Name | tetrakis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) butane-1,1,2,4-tetracarboxylate |
|---|---|
| PubChem CID | 121247839 |
| Molecular Formula | C52H94N4O8 |
| Molecular Weight | 903.34 g/mol |
| Exact Mass | 902.71 |
| IUPAC Name | tetrakis(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) butane-1,1,2,4-tetracarboxylate |
| SMILES | CC(C)C1(C)CC(OC(=O)CCC(C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)C(C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C52H94N4O8/c1-31(2)49(17)27-35(23-45(9,10)53-49)61-40(57)22-21-39(42(58)62-36-24-46(11,12)54-50(18,28-36)32(3)4)41(43(59)63-37-25-47(13,14)55-51(19,29-37)33(5)6)44(60)64-38-26-48(15,16)56-52(20,30-38)34(7)8/h31-39,41,53-56H,21-30H2,1-20H3 |
| InChIKey | LNAUOYPYMWSNBB-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.34 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|