C56H101N3O8 — CID 159323254
2-O-(3,3,5-trimethyl-5-propan-2-ylcyclohexyl) 1-O,1-O,7-O-tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,2,7-tetracarboxylate (PubChem CID 159323254) has the molecular formula C56H101N3O8 and a molecular weight of 944.44 g/mol. Its IUPAC name is 2-O-(3,3,5-trimethyl-5-propan-2-ylcyclohexyl) 1-O,1-O,7-O-tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,2,7-tetracarboxylate.
| Compound Name | 2-O-(3,3,5-trimethyl-5-propan-2-ylcyclohexyl) 1-O,1-O,7-O-tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,2,7-tetracarboxylate |
|---|---|
| PubChem CID | 159323254 |
| Molecular Formula | C56H101N3O8 |
| Molecular Weight | 944.44 g/mol |
| Exact Mass | 943.76 |
| IUPAC Name | 2-O-(3,3,5-trimethyl-5-propan-2-ylcyclohexyl) 1-O,1-O,7-O-tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,2,7-tetracarboxylate |
| SMILES | CC(C)C1(C)CC(OC(=O)C(CCCCCC(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)C(C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C56H101N3O8/c1-35(2)53(17)30-39(26-49(9,10)34-53)65-46(61)43(24-22-21-23-25-44(60)64-40-27-50(11,12)57-54(18,31-40)36(3)4)45(47(62)66-41-28-51(13,14)58-55(19,32-41)37(5)6)48(63)67-42-29-52(15,16)59-56(20,33-42)38(7)8/h35-43,45,57-59H,21-34H2,1-20H3 |
| InChIKey | LEAMVRATZUBZQT-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.44 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|