C30H56N2O4 — CID 137448538
bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-ethyldecanedioate (PubChem CID 137448538) has the molecular formula C30H56N2O4 and a molecular weight of 508.79 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-ethyldecanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-ethyldecanedioate |
|---|---|
| PubChem CID | 137448538 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-ethyldecanedioate |
| SMILES | CCC(CCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1)CC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C30H56N2O4/c1-10-22(17-26(34)36-24-20-29(6,7)32-30(8,9)21-24)15-13-11-12-14-16-25(33)35-23-18-27(2,3)31-28(4,5)19-23/h22-24,31-32H,10-21H2,1-9H3 |
| InChIKey | NDDDAUXXWPZOPP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|