C30H54N2O4 — CID 122433569
10-O-(2,2,6,6-tetramethyl-1-azabicyclo[2.2.0]hexan-4-yl) 1-O-(2,2,6,6-tetramethylpiperidin-4-yl) 2-ethyldecanedioate (PubChem CID 122433569) has the molecular formula C30H54N2O4 and a molecular weight of 506.77 g/mol. Its IUPAC name is 10-O-(2,2,6,6-tetramethyl-1-azabicyclo[2.2.0]hexan-4-yl) 1-O-(2,2,6,6-tetramethylpiperidin-4-yl) 2-ethyldecanedioate.
| Compound Name | 10-O-(2,2,6,6-tetramethyl-1-azabicyclo[2.2.0]hexan-4-yl) 1-O-(2,2,6,6-tetramethylpiperidin-4-yl) 2-ethyldecanedioate |
|---|---|
| PubChem CID | 122433569 |
| Molecular Formula | C30H54N2O4 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | 10-O-(2,2,6,6-tetramethyl-1-azabicyclo[2.2.0]hexan-4-yl) 1-O-(2,2,6,6-tetramethylpiperidin-4-yl) 2-ethyldecanedioate |
| SMILES | CCC(CCCCCCCC(=O)OC12CC(C)(C)N1C(C)(C)C2)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C30H54N2O4/c1-10-22(25(34)35-23-18-26(2,3)31-27(4,5)19-23)16-14-12-11-13-15-17-24(33)36-30-20-28(6,7)32(30)29(8,9)21-30/h22-23,31H,10-21H2,1-9H3 |
| InChIKey | XDJQXNZUIPYLKC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|