C21H39NO3 — CID 126548120
(2,2,6,6-tetramethylpiperidin-4-yl) 9-formylundecanoate (PubChem CID 126548120) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 9-formylundecanoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 9-formylundecanoate |
|---|---|
| PubChem CID | 126548120 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 9-formylundecanoate |
| SMILES | CCC(C=O)CCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H39NO3/c1-6-17(16-23)12-10-8-7-9-11-13-19(24)25-18-14-20(2,3)22-21(4,5)15-18/h16-18,22H,6-15H2,1-5H3 |
| InChIKey | LEIXHWNMXUPDAF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|