C19H33NO6 — CID 76638051
4-(hydroxymethyl)-9-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-oxonon-2-enoic acid (PubChem CID 76638051) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 4-(hydroxymethyl)-9-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-oxonon-2-enoic acid.
| Compound Name | 4-(hydroxymethyl)-9-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-oxonon-2-enoic acid |
|---|---|
| PubChem CID | 76638051 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 4-(hydroxymethyl)-9-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-oxonon-2-enoic acid |
| SMILES | CC1(C)CC(OC(=O)CCCCC(C=CC(=O)O)CO)CC(C)(C)N1O |
| InChI | InChI=1S/C19H33NO6/c1-18(2)11-15(12-19(3,4)20(18)25)26-17(24)8-6-5-7-14(13-21)9-10-16(22)23/h9-10,14-15,21,25H,5-8,11-13H2,1-4H3,(H,22,23) |
| InChIKey | INDSUUDTGHTLDC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|