C30H56N2O5 — CID 118137040
10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methyldecanedioate (PubChem CID 118137040) has the molecular formula C30H56N2O5 and a molecular weight of 524.79 g/mol. Its IUPAC name is 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methyldecanedioate.
| Compound Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methyldecanedioate |
|---|---|
| PubChem CID | 118137040 |
| Molecular Formula | C30H56N2O5 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.42 |
| IUPAC Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methyldecanedioate |
| SMILES | CC(CCCCCCCC(=O)OC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C30H56N2O5/c1-22(26(34)37-24-18-27(2,3)31(10)28(4,5)19-24)16-14-12-11-13-15-17-25(33)36-23-20-29(6,7)32(35)30(8,9)21-23/h22-24,35H,11-21H2,1-10H3 |
| InChIKey | CBBUNJAZOADKFM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|