C30H56N2O4 — CID 66781134
10-oxo-7-(1,2,2,6,6-pentamethylpiperidin-4-yl)-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoic acid (PubChem CID 66781134) has the molecular formula C30H56N2O4 and a molecular weight of 508.79 g/mol. Its IUPAC name is 10-oxo-7-(1,2,2,6,6-pentamethylpiperidin-4-yl)-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoic acid.
| Compound Name | 10-oxo-7-(1,2,2,6,6-pentamethylpiperidin-4-yl)-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoic acid |
|---|---|
| PubChem CID | 66781134 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | 10-oxo-7-(1,2,2,6,6-pentamethylpiperidin-4-yl)-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoic acid |
| SMILES | CN1C(C)(C)CC(OC(=O)CCC(CCCCCC(=O)O)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C30H56N2O4/c1-27(2)18-23(19-28(3,4)31(27)9)22(14-12-11-13-15-25(33)34)16-17-26(35)36-24-20-29(5,6)32(10)30(7,8)21-24/h22-24H,11-21H2,1-10H3,(H,33,34) |
| InChIKey | NREUJAMIKBJKQG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|