C31H57NO8 — CID 174929371
decanedioic acid;10-methoxy-10-oxo-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)decanoic acid (PubChem CID 174929371) has the molecular formula C31H57NO8 and a molecular weight of 571.80 g/mol. Its IUPAC name is decanedioic acid;10-methoxy-10-oxo-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)decanoic acid.
| Compound Name | decanedioic acid;10-methoxy-10-oxo-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)decanoic acid |
|---|---|
| PubChem CID | 174929371 |
| Molecular Formula | C31H57NO8 |
| Molecular Weight | 571.80 g/mol |
| Exact Mass | 571.41 |
| IUPAC Name | decanedioic acid;10-methoxy-10-oxo-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)decanoic acid |
| SMILES | COC(=O)CCCCCCC(CC(=O)O)C1CC(C)(C)N(C)C(C)(C)C1.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C21H39NO4.C10H18O4/c1-20(2)14-17(15-21(3,4)22(20)5)16(13-18(23)24)11-9-7-8-10-12-19(25)26-6;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h16-17H,7-15H2,1-6H3,(H,23,24);1-8H2,(H,11,12)(H,13,14) |
| InChIKey | VEIZGBNONLPLFZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.80 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|