About 8-methoxy-8-oxooctanoic acid;hydrochloride
8-methoxy-8-oxooctanoic acid;hydrochloride (PubChem CID 87214836) has the molecular formula C9H17ClO4
and a molecular weight of 224.68 g/mol. Its IUPAC name is 8-methoxy-8-oxooctanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 8-methoxy-8-oxooctanoic acid;hydrochloride |
| PubChem CID | 87214836 |
| Molecular Formula | C9H17ClO4 |
| Molecular Weight | 224.68 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 8-methoxy-8-oxooctanoic acid;hydrochloride |
| SMILES | COC(=O)CCCCCCC(=O)O.Cl |
| InChI | InChI=1S/C9H16O4.ClH/c1-13-9(12)7-5-3-2-4-6-8(10)11;/h2-7H2,1H3,(H,10,11);1H |
| InChIKey | HZLLHGVQEZDRGO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-8-oxooctanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-8-oxooctanoic acid;hydrochloride?
The IUPAC name of 8-methoxy-8-oxooctanoic acid;hydrochloride (CID 87214836) is 8-methoxy-8-oxooctanoic acid;hydrochloride.
What is the SMILES notation for 8-methoxy-8-oxooctanoic acid;hydrochloride?
The canonical SMILES for 8-methoxy-8-oxooctanoic acid;hydrochloride is COC(=O)CCCCCCC(=O)O.Cl.
What is the InChIKey of 8-methoxy-8-oxooctanoic acid;hydrochloride?
The InChIKey is HZLLHGVQEZDRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.ClH/c1-13-9(12)7-5-3-2-4-6-8(10)11;/h2-7H2,1H3,(H,10,11);1H.
What are the key properties of 8-methoxy-8-oxooctanoic acid;hydrochloride?
8-methoxy-8-oxooctanoic acid;hydrochloride has a molecular weight of 224.68 g/mol, XLogP of 2.01, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-8-oxooctanoic acid;hydrochloride is sourced from PubChem (CID 87214836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).