About 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine
13-methoxy-13-oxotridecanoic acid;N-methylmethanamine (PubChem CID 88504944) has the molecular formula C16H33NO4
and a molecular weight of 303.44 g/mol. Its IUPAC name is 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine |
| PubChem CID | 88504944 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine |
| SMILES | CNC.COC(=O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H26O4.C2H7N/c1-18-14(17)12-10-8-6-4-2-3-5-7-9-11-13(15)16;1-3-2/h2-12H2,1H3,(H,15,16);3H,1-2H3 |
| InChIKey | FSWIHONZEBCPKQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine?
The IUPAC name of 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine (CID 88504944) is 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine.
What is the SMILES notation for 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine?
The canonical SMILES for 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine is CNC.COC(=O)CCCCCCCCCCCC(=O)O.
What is the InChIKey of 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine?
The InChIKey is FSWIHONZEBCPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.C2H7N/c1-18-14(17)12-10-8-6-4-2-3-5-7-9-11-13(15)16;1-3-2/h2-12H2,1H3,(H,15,16);3H,1-2H3.
What are the key properties of 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine?
13-methoxy-13-oxotridecanoic acid;N-methylmethanamine has a molecular weight of 303.44 g/mol, XLogP of 3.37, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 13-methoxy-13-oxotridecanoic acid;N-methylmethanamine is sourced from PubChem (CID 88504944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).