C27H51NO4 — CID 150087158
10-oxo-10-(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl)oxydecanoic acid (PubChem CID 150087158) has the molecular formula C27H51NO4 and a molecular weight of 453.71 g/mol. Its IUPAC name is 10-oxo-10-(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl)oxydecanoic acid.
| Compound Name | 10-oxo-10-(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl)oxydecanoic acid |
|---|---|
| PubChem CID | 150087158 |
| Molecular Formula | C27H51NO4 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.38 |
| IUPAC Name | 10-oxo-10-(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl)oxydecanoic acid |
| SMILES | CCCCCCCCN1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)O)CC1(C)C |
| InChI | InChI=1S/C27H51NO4/c1-6-7-8-9-14-17-20-28-26(2,3)21-23(22-27(28,4)5)32-25(31)19-16-13-11-10-12-15-18-24(29)30/h23H,6-22H2,1-5H3,(H,29,30) |
| InChIKey | DSLWAORZDFZIHV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|