C41H78N2O4 — CID 20512159
bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-diethylpropanedioate (PubChem CID 20512159) has the molecular formula C41H78N2O4 and a molecular weight of 663.08 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-diethylpropanedioate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 20512159 |
| Molecular Formula | C41H78N2O4 |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.60 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCN1C(C)(C)CC(OC(=O)C(CC)(CC)C(=O)OC2CC(C)(C)N(CCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C41H78N2O4/c1-13-17-19-21-23-25-27-42-37(5,6)29-33(30-38(42,7)8)46-35(44)41(15-3,16-4)36(45)47-34-31-39(9,10)43(40(11,12)32-34)28-26-24-22-20-18-14-2/h33-34H,13-32H2,1-12H3 |
| InChIKey | COPXTPWRSPZDOO-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|