C34H64N2O — CID 70542587
1-hexyl-4-[2-[2-(1-hexyl-2,2,6,6-tetramethylpiperidin-4-yl)ethenoxy]ethenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 70542587) has the molecular formula C34H64N2O and a molecular weight of 516.90 g/mol. Its IUPAC name is 1-hexyl-4-[2-[2-(1-hexyl-2,2,6,6-tetramethylpiperidin-4-yl)ethenoxy]ethenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hexyl-4-[2-[2-(1-hexyl-2,2,6,6-tetramethylpiperidin-4-yl)ethenoxy]ethenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 70542587 |
| Molecular Formula | C34H64N2O |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.50 |
| IUPAC Name | 1-hexyl-4-[2-[2-(1-hexyl-2,2,6,6-tetramethylpiperidin-4-yl)ethenoxy]ethenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCCCN1C(C)(C)CC(C=COC=CC2CC(C)(C)N(CCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C34H64N2O/c1-11-13-15-17-21-35-31(3,4)25-29(26-32(35,5)6)19-23-37-24-20-30-27-33(7,8)36(34(9,10)28-30)22-18-16-14-12-2/h19-20,23-24,29-30H,11-18,21-22,25-28H2,1-10H3 |
| InChIKey | GVUONUZUQSEXFS-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|