C13H27NO2 — CID 174827050
2-(4-ethoxy-2,2,6,6-tetramethylpiperidin-1-yl)ethanol (PubChem CID 174827050) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(4-ethoxy-2,2,6,6-tetramethylpiperidin-1-yl)ethanol.
| Compound Name | 2-(4-ethoxy-2,2,6,6-tetramethylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 174827050 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(4-ethoxy-2,2,6,6-tetramethylpiperidin-1-yl)ethanol |
| SMILES | CCOC1CC(C)(C)N(CCO)C(C)(C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-6-16-11-9-12(2,3)14(7-8-15)13(4,5)10-11/h11,15H,6-10H2,1-5H3 |
| InChIKey | ICELEJDSTVJLRB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |