C19H31NO2 — CID 135259547
3-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-1-ol (PubChem CID 135259547) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-1-ol.
| Compound Name | 3-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-1-ol |
|---|---|
| PubChem CID | 135259547 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-1-ol |
| SMILES | CC1(C)CC(OCCCO)CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H31NO2/c1-18(2)13-17(22-12-8-11-21)14-19(3,4)20(18)15-16-9-6-5-7-10-16/h5-7,9-10,17,21H,8,11-15H2,1-4H3 |
| InChIKey | FQJBTJSHISGSES-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|