C36H50N2O4 — CID 87175148
(E)-2,3-bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioic acid (PubChem CID 87175148) has the molecular formula C36H50N2O4 and a molecular weight of 574.81 g/mol. Its IUPAC name is (E)-2,3-bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioic acid.
| Compound Name | (E)-2,3-bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 87175148 |
| Molecular Formula | C36H50N2O4 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.38 |
| IUPAC Name | (E)-2,3-bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioic acid |
| SMILES | CC1(C)CC(/C(C(=O)O)=C(\C(=O)O)C2CC(C)(C)N(Cc3ccccc3)C(C)(C)C2)CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C36H50N2O4/c1-33(2)19-27(20-34(3,4)37(33)23-25-15-11-9-12-16-25)29(31(39)40)30(32(41)42)28-21-35(5,6)38(36(7,8)22-28)24-26-17-13-10-14-18-26/h9-18,27-28H,19-24H2,1-8H3,(H,39,40)(H,41,42)/b30-29+ |
| InChIKey | CFCOFNZXDNUEJF-QVIHXGFCSA-N |
| XLogP | 7.39 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|