C20H25NO4-2 — CID 22507419
(Z)-2-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioate (PubChem CID 22507419) has the molecular formula C20H25NO4-2 and a molecular weight of 343.42 g/mol. Its IUPAC name is (Z)-2-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioate.
| Compound Name | (Z)-2-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioate |
|---|---|
| PubChem CID | 22507419 |
| Molecular Formula | C20H25NO4-2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (Z)-2-(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl)but-2-enedioate |
| SMILES | CC1(C)CC(/C(=C/C(=O)[O-])C(=O)[O-])CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO4/c1-19(2)11-15(16(18(24)25)10-17(22)23)12-20(3,4)21(19)13-14-8-6-5-7-9-14/h5-10,15H,11-13H2,1-4H3,(H,22,23)(H,24,25)/p-2/b16-10- |
| InChIKey | GCSMUZTVTUMTPM-YBEGLDIGSA-L |
| XLogP | 0.88 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|