C41H58N2O4 — CID 54571692
bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) (1S,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 54571692) has the molecular formula C41H58N2O4 and a molecular weight of 642.93 g/mol. Its IUPAC name is bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) (1S,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) (1S,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 54571692 |
| Molecular Formula | C41H58N2O4 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) (1S,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)C2C(C(=O)OC3CC(C)(C)N(Cc4ccccc4)C(C)(C)C3)[C@H]3CC[C@@H]2C3)CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C41H58N2O4/c1-38(2)22-32(23-39(3,4)42(38)26-28-15-11-9-12-16-28)46-36(44)34-30-19-20-31(21-30)35(34)37(45)47-33-24-40(5,6)43(41(7,8)25-33)27-29-17-13-10-14-18-29/h9-18,30-35H,19-27H2,1-8H3/t30-,31+,34?,35? |
| InChIKey | ZXSWIFCTAVMGFN-OHISJQBDSA-N |
| XLogP | 8.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |