C39H58N2O6 — CID 57063329
[1-[7-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 57063329) has the molecular formula C39H58N2O6 and a molecular weight of 650.90 g/mol. Its IUPAC name is [1-[7-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[7-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 57063329 |
| Molecular Formula | C39H58N2O6 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | [1-[7-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1OCCCCCCCON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C39H58N2O6/c1-36(2)26-32(46-34(42)30-20-14-12-15-21-30)27-37(3,4)40(36)44-24-18-10-9-11-19-25-45-41-38(5,6)28-33(29-39(41,7)8)47-35(43)31-22-16-13-17-23-31/h12-17,20-23,32-33H,9-11,18-19,24-29H2,1-8H3 |
| InChIKey | TWSVUXZFRSSKSJ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|