C52H79N3O8 — CID 158307203
1,4-dimethoxy-2,2,6,6-tetramethylpiperidine;(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzoate;[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzoate (PubChem CID 158307203) has the molecular formula C52H79N3O8 and a molecular weight of 874.22 g/mol. Its IUPAC name is 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine;(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzoate;[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzoate.
| Compound Name | 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine;(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzoate;[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 158307203 |
| Molecular Formula | C52H79N3O8 |
| Molecular Weight | 874.22 g/mol |
| Exact Mass | 873.59 |
| IUPAC Name | 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine;(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzoate;[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzoate |
| SMILES | CC(ON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C)c1ccccc1.COC1CC(C)(C)N(OC)C(C)(C)C1.CON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C24H31NO3.C17H25NO3.C11H23NO2/c1-18(19-12-8-6-9-13-19)28-25-23(2,3)16-21(17-24(25,4)5)27-22(26)20-14-10-7-11-15-20;1-16(2)11-14(12-17(3,4)18(16)20-5)21-15(19)13-9-7-6-8-10-13;1-10(2)7-9(13-5)8-11(3,4)12(10)14-6/h6-15,18,21H,16-17H2,1-5H3;6-10,14H,11-12H2,1-5H3;9H,7-8H2,1-6H3 |
| InChIKey | GNFMNSGYTPRXBB-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 99.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.22 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |