C25H41NO3 — CID 21361369
[2-ethyl-2,6,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] heptanoate (PubChem CID 21361369) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is [2-ethyl-2,6,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] heptanoate.
| Compound Name | [2-ethyl-2,6,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] heptanoate |
|---|---|
| PubChem CID | 21361369 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | [2-ethyl-2,6,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC1CC(C)(C)N(OC(C)c2ccccc2)C(C)(CC)C1 |
| InChI | InChI=1S/C25H41NO3/c1-7-9-10-14-17-23(27)28-22-18-24(4,5)26(25(6,8-2)19-22)29-20(3)21-15-12-11-13-16-21/h11-13,15-16,20,22H,7-10,14,17-19H2,1-6H3 |
| InChIKey | KPVNXUAIXGJUPV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|