C28H48N2O2 — CID 129394565
N-[(4S)-2,2-diethyl-6,6-dimethyl-1-[(1S)-1-phenylethoxy]piperidin-4-yl]nonanamide (PubChem CID 129394565) has the molecular formula C28H48N2O2 and a molecular weight of 444.70 g/mol. Its IUPAC name is N-[(4S)-2,2-diethyl-6,6-dimethyl-1-[(1S)-1-phenylethoxy]piperidin-4-yl]nonanamide.
| Compound Name | N-[(4S)-2,2-diethyl-6,6-dimethyl-1-[(1S)-1-phenylethoxy]piperidin-4-yl]nonanamide |
|---|---|
| PubChem CID | 129394565 |
| Molecular Formula | C28H48N2O2 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.37 |
| IUPAC Name | N-[(4S)-2,2-diethyl-6,6-dimethyl-1-[(1S)-1-phenylethoxy]piperidin-4-yl]nonanamide |
| SMILES | CCCCCCCCC(=O)N[C@H]1CC(C)(C)N(O[C@@H](C)c2ccccc2)C(CC)(CC)C1 |
| InChI | InChI=1S/C28H48N2O2/c1-7-10-11-12-13-17-20-26(31)29-25-21-27(5,6)30(28(8-2,9-3)22-25)32-23(4)24-18-15-14-16-19-24/h14-16,18-19,23,25H,7-13,17,20-22H2,1-6H3,(H,29,31)/t23-,25-/m0/s1 |
| InChIKey | CNQNJNRAAVBISV-ZCYQVOJMSA-N |
| XLogP | 7.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|