C27H46N2O2 — CID 22992781
N-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]octanamide (PubChem CID 22992781) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is N-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]octanamide.
| Compound Name | N-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]octanamide |
|---|---|
| PubChem CID | 22992781 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | N-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC1CC(C)(C)N(OC(C)c2ccccc2)C(CC)(CC)C1 |
| InChI | InChI=1S/C27H46N2O2/c1-7-10-11-12-16-19-25(30)28-24-20-26(5,6)29(27(8-2,9-3)21-24)31-22(4)23-17-14-13-15-18-23/h13-15,17-18,22,24H,7-12,16,19-21H2,1-6H3,(H,28,30) |
| InChIKey | BXLZHZOAVPYPLN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|