C26H42N2O4 — CID 21361380
6-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-6-oxohexanoic acid (PubChem CID 21361380) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 6-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 21361380 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 6-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-6-oxohexanoic acid |
| SMILES | CCC1(C)CC(NC(=O)CCCCC(=O)O)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C26H42N2O4/c1-7-25(5)18-22(27-23(29)16-12-13-17-24(30)31)19(3)26(6,8-2)28(25)32-20(4)21-14-10-9-11-15-21/h9-11,14-15,19-20,22H,7-8,12-13,16-18H2,1-6H3,(H,27,29)(H,30,31) |
| InChIKey | QXVLZJYTSOQOKK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|