C26H38N2O3 — CID 22992818
1-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 22992818) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 22992818 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 1-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CCC1(C)CC(N2C(=O)C(C)=C(C)C2=O)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C26H38N2O3/c1-9-25(7)16-22(27-23(29)17(3)18(4)24(27)30)19(5)26(8,10-2)28(25)31-20(6)21-14-12-11-13-15-21/h11-15,19-20,22H,9-10,16H2,1-8H3 |
| InChIKey | FPIHNRBHCLZNFD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|