C23H36N2O4 — CID 21361395
methyl 2-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-2-oxoacetate (PubChem CID 21361395) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl 2-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 21361395 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl 2-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-2-oxoacetate |
| SMILES | CCC1(C)CC(NC(=O)C(=O)OC)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C23H36N2O4/c1-8-22(5)15-19(24-20(26)21(27)28-7)16(3)23(6,9-2)25(22)29-17(4)18-13-11-10-12-14-18/h10-14,16-17,19H,8-9,15H2,1-7H3,(H,24,26) |
| InChIKey | UFUWAAAANGZWIR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|