C25H38N2O4 — CID 21361400
methyl (E)-4-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-4-oxobut-2-enoate (PubChem CID 21361400) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl (E)-4-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 21361400 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | methyl (E)-4-[[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]amino]-4-oxobut-2-enoate |
| SMILES | CCC1(C)CC(NC(=O)/C=C/C(=O)OC)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C25H38N2O4/c1-8-24(5)17-21(26-22(28)15-16-23(29)30-7)18(3)25(6,9-2)27(24)31-19(4)20-13-11-10-12-14-20/h10-16,18-19,21H,8-9,17H2,1-7H3,(H,26,28)/b16-15+ |
| InChIKey | IEKFTJLVVBNCJS-FOCLMDBBSA-N |
| XLogP | 4.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|