C21H34N2O2 — CID 73446136
2,6-diethyl-N-methoxy-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-imine (PubChem CID 73446136) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2,6-diethyl-N-methoxy-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-imine.
| Compound Name | 2,6-diethyl-N-methoxy-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-imine |
|---|---|
| PubChem CID | 73446136 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 2,6-diethyl-N-methoxy-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-imine |
| SMILES | CCC1(C)CC(=NOC)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C21H34N2O2/c1-8-20(5)15-19(22-24-7)16(3)21(6,9-2)23(20)25-17(4)18-13-11-10-12-14-18/h10-14,16-17H,8-9,15H2,1-7H3 |
| InChIKey | NWEMWNJAKUMBEE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|