C19H31NO2 — CID 89097657
4-ethoxy-2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine (PubChem CID 89097657) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-ethoxy-2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine.
| Compound Name | 4-ethoxy-2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
|---|---|
| PubChem CID | 89097657 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 4-ethoxy-2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
| SMILES | CCOC1CC(C)(C)N(OC(C)c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C19H31NO2/c1-7-21-17-13-18(3,4)20(19(5,6)14-17)22-15(2)16-11-9-8-10-12-16/h8-12,15,17H,7,13-14H2,1-6H3 |
| InChIKey | XYGNZFBNWJQJDE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |