C17H26N2O2 — CID 91502421
2,2,6,6-tetramethyl-4-nitroso-1-(1-phenylethoxy)piperidine (PubChem CID 91502421) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-nitroso-1-(1-phenylethoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-nitroso-1-(1-phenylethoxy)piperidine |
|---|---|
| PubChem CID | 91502421 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-nitroso-1-(1-phenylethoxy)piperidine |
| SMILES | CC(ON1C(C)(C)CC(N=O)CC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-13(14-9-7-6-8-10-14)21-19-16(2,3)11-15(18-20)12-17(19,4)5/h6-10,13,15H,11-12H2,1-5H3 |
| InChIKey | CWCPTHWGZKIING-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |