C23H37NO5 — CID 142146379
formic acid;3,3,8,8,10,10-hexamethyl-9-(1-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 142146379) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is formic acid;3,3,8,8,10,10-hexamethyl-9-(1-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | formic acid;3,3,8,8,10,10-hexamethyl-9-(1-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142146379 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | formic acid;3,3,8,8,10,10-hexamethyl-9-(1-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OCC(C)(C)CO2)c1ccccc1.O=CO |
| InChI | InChI=1S/C22H35NO3.CH2O2/c1-17(18-11-9-8-10-12-18)26-23-20(4,5)13-22(14-21(23,6)7)24-15-19(2,3)16-25-22;2-1-3/h8-12,17H,13-16H2,1-7H3;1H,(H,2,3) |
| InChIKey | STASXRZVTSPOTL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|