C45H66N2O10 — CID 58759284
2,2,4,4,14,14,16,16-octamethyl-3,15-bis[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane (PubChem CID 58759284) has the molecular formula C45H66N2O10 and a molecular weight of 795.03 g/mol. Its IUPAC name is 2,2,4,4,14,14,16,16-octamethyl-3,15-bis[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane.
| Compound Name | 2,2,4,4,14,14,16,16-octamethyl-3,15-bis[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane |
|---|---|
| PubChem CID | 58759284 |
| Molecular Formula | C45H66N2O10 |
| Molecular Weight | 795.03 g/mol |
| Exact Mass | 794.47 |
| IUPAC Name | 2,2,4,4,14,14,16,16-octamethyl-3,15-bis[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OCC1(CO2)COC2(CC(C)(C)N(OC(C)c3ccc(OCC4CO4)cc3)C(C)(C)C2)OC1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C45H66N2O10/c1-31(33-11-15-35(16-12-33)48-19-37-21-50-37)56-46-39(3,4)23-44(24-40(46,5)6)52-27-43(28-53-44)29-54-45(55-30-43)25-41(7,8)47(42(9,10)26-45)57-32(2)34-13-17-36(18-14-34)49-20-38-22-51-38/h11-18,31-32,37-38H,19-30H2,1-10H3 |
| InChIKey | ICHUWLJRKPGFDN-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 105.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.03 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|